C23H31ClLiO7P — CID 173245190
lithium;(2-chloro-6-methylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245190) has the molecular formula C23H31ClLiO7P and a molecular weight of 492.86 g/mol. Its IUPAC name is lithium;(2-chloro-6-methylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2-chloro-6-methylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245190 |
| Molecular Formula | C23H31ClLiO7P |
| Molecular Weight | 492.86 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | lithium;(2-chloro-6-methylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COC(C)Oc1cc(OC(C)OC)c(PC(=O)c2c(C)cccc2Cl)c(OC(C)OC)c1.[H-].[Li+] |
| InChI | InChI=1S/C23H30ClO7P.Li.H/c1-13-9-8-10-18(24)21(13)23(25)32-22-19(30-15(3)27-6)11-17(29-14(2)26-5)12-20(22)31-16(4)28-7;;/h8-12,14-16,32H,1-7H3;;/q;+1;-1 |
| InChIKey | UBSLTGBDCPQLIT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|