C27H40LiO4P — CID 173244432
lithium;(2,6-dimethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173244432) has the molecular formula C27H40LiO4P and a molecular weight of 466.53 g/mol. Its IUPAC name is lithium;(2,6-dimethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244432 |
| Molecular Formula | C27H40LiO4P |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | lithium;(2,6-dimethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCC(C)Oc1cc(OC(C)CC)c(PC(=O)c2c(C)cccc2C)c(OC(C)CC)c1.[H-].[Li+] |
| InChI | InChI=1S/C27H39O4P.Li.H/c1-9-19(6)29-22-15-23(30-20(7)10-2)26(24(16-22)31-21(8)11-3)32-27(28)25-17(4)13-12-14-18(25)5;;/h12-16,19-21,32H,9-11H2,1-8H3;;/q;+1;-1 |
| InChIKey | WCNICZPWRVHKPX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|