C23H32LiO2P — CID 173244242
lithium;(4-butan-2-yloxyphenyl)phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone;hydride (PubChem CID 173244242) has the molecular formula C23H32LiO2P and a molecular weight of 378.42 g/mol. Its IUPAC name is lithium;(4-butan-2-yloxyphenyl)phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone;hydride.
| Compound Name | lithium;(4-butan-2-yloxyphenyl)phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244242 |
| Molecular Formula | C23H32LiO2P |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | lithium;(4-butan-2-yloxyphenyl)phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone;hydride |
| SMILES | CCC(C)Oc1ccc(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)cc1.[H-].[Li+] |
| InChI | InChI=1S/C23H31O2P.Li.H/c1-8-17(4)25-19-9-11-20(12-10-19)26-22(24)21-15(2)13-18(14-16(21)3)23(5,6)7;;/h9-14,17,26H,8H2,1-7H3;;/q;+1;-1 |
| InChIKey | GTHQOQYCOVFDNX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|