C19H18F6LiO2P — CID 173243904
lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-butan-2-yloxyphenyl)phosphanylmethanone;hydride (PubChem CID 173243904) has the molecular formula C19H18F6LiO2P and a molecular weight of 430.25 g/mol. Its IUPAC name is lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-butan-2-yloxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-butan-2-yloxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243904 |
| Molecular Formula | C19H18F6LiO2P |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(4-butan-2-yloxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCC(C)Oc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)cc1.[H-].[Li+] |
| InChI | InChI=1S/C19H17F6O2P.Li.H/c1-3-11(2)27-12-7-9-13(10-8-12)28-17(26)16-14(18(20,21)22)5-4-6-15(16)19(23,24)25;;/h4-11,28H,3H2,1-2H3;;/q;+1;-1 |
| InChIKey | GBYGFNLAZPUONP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|