C26H36ClO8P — CID 70012807
(2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-ethoxyethoxy)phenyl]phosphanylmethanone (PubChem CID 70012807) has the molecular formula C26H36ClO8P and a molecular weight of 542.99 g/mol. Its IUPAC name is (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-ethoxyethoxy)phenyl]phosphanylmethanone.
| Compound Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-ethoxyethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 70012807 |
| Molecular Formula | C26H36ClO8P |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-ethoxyethoxy)phenyl]phosphanylmethanone |
| SMILES | CCOCCOc1cc(OCCOCC)c(PC(=O)c2c(Cl)cccc2OC)c(OCCOCC)c1 |
| InChI | InChI=1S/C26H36ClO8P/c1-5-30-11-14-33-19-17-22(34-15-12-31-6-2)25(23(18-19)35-16-13-32-7-3)36-26(28)24-20(27)9-8-10-21(24)29-4/h8-10,17-18,36H,5-7,11-16H2,1-4H3 |
| InChIKey | VXQMYXXQNGHASK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|