C35H30ClO5P — CID 18515179
(2-chloro-6-methoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone (PubChem CID 18515179) has the molecular formula C35H30ClO5P and a molecular weight of 597.05 g/mol. Its IUPAC name is (2-chloro-6-methoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone.
| Compound Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18515179 |
| Molecular Formula | C35H30ClO5P |
| Molecular Weight | 597.05 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone |
| SMILES | COc1cccc(Cl)c1C(=O)Pc1c(OCc2ccccc2)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H30ClO5P/c1-38-30-19-11-18-29(36)33(30)35(37)42-34-31(40-23-26-14-7-3-8-15-26)20-28(39-22-25-12-5-2-6-13-25)21-32(34)41-24-27-16-9-4-10-17-27/h2-21,42H,22-24H2,1H3 |
| InChIKey | GIIVCIBMTOMKJT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.05 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|