C28H24ClLiO4P — CID 70012742
CID 70012742 (PubChem CID 70012742) has the molecular formula C28H24ClLiO4P and a molecular weight of 497.86 g/mol.
| Compound Name | CID 70012742 |
|---|---|
| PubChem CID | 70012742 |
| Molecular Formula | C28H24ClLiO4P |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | — |
| SMILES | COc1cccc(Cl)c1C(=O)Pc1ccc(OCc2ccccc2)cc1OCc1ccccc1.[Li] |
| InChI | InChI=1S/C28H24ClO4P.Li/c1-31-24-14-8-13-23(29)27(24)28(30)34-26-16-15-22(32-18-20-9-4-2-5-10-20)17-25(26)33-19-21-11-6-3-7-12-21;/h2-17,34H,18-19H2,1H3; |
| InChIKey | DDKIKZVXOBXYPW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|