C19H21Cl2O4P — CID 70014873
(2,6-dichloro-4-ethoxyphenyl)-[2-(2-ethoxyethoxy)phenyl]phosphanylmethanone (PubChem CID 70014873) has the molecular formula C19H21Cl2O4P and a molecular weight of 415.25 g/mol. Its IUPAC name is (2,6-dichloro-4-ethoxyphenyl)-[2-(2-ethoxyethoxy)phenyl]phosphanylmethanone.
| Compound Name | (2,6-dichloro-4-ethoxyphenyl)-[2-(2-ethoxyethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 70014873 |
| Molecular Formula | C19H21Cl2O4P |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (2,6-dichloro-4-ethoxyphenyl)-[2-(2-ethoxyethoxy)phenyl]phosphanylmethanone |
| SMILES | CCOCCOc1ccccc1PC(=O)c1c(Cl)cc(OCC)cc1Cl |
| InChI | InChI=1S/C19H21Cl2O4P/c1-3-23-9-10-25-16-7-5-6-8-17(16)26-19(22)18-14(20)11-13(24-4-2)12-15(18)21/h5-8,11-12,26H,3-4,9-10H2,1-2H3 |
| InChIKey | XUAPYLIWKFQFMI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|