C27H40LiO6P — CID 173245850
lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245850) has the molecular formula C27H40LiO6P and a molecular weight of 498.53 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245850 |
| Molecular Formula | C27H40LiO6P |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COc1cccc(OC)c1C(=O)Pc1c(OCC(C)C)cc(OCC(C)C)cc1OCC(C)C.[H-].[Li+] |
| InChI | InChI=1S/C27H39O6P.Li.H/c1-17(2)14-31-20-12-23(32-15-18(3)4)26(24(13-20)33-16-19(5)6)34-27(28)25-21(29-7)10-9-11-22(25)30-8;;/h9-13,17-19,34H,14-16H2,1-8H3;;/q;+1;-1 |
| InChIKey | ASJMXITTWYTYDP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|