C27H39LiO6P — CID 70016726
CID 70016726 (PubChem CID 70016726) has the molecular formula C27H39LiO6P and a molecular weight of 497.52 g/mol.
| Compound Name | CID 70016726 |
|---|---|
| PubChem CID | 70016726 |
| Molecular Formula | C27H39LiO6P |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | — |
| SMILES | COc1cccc(OC)c1C(=O)Pc1c(OCC(C)C)cc(OCC(C)C)cc1OCC(C)C.[Li] |
| InChI | InChI=1S/C27H39O6P.Li/c1-17(2)14-31-20-12-23(32-15-18(3)4)26(24(13-20)33-16-19(5)6)34-27(28)25-21(29-7)10-9-11-22(25)30-8;/h9-13,17-19,34H,14-16H2,1-8H3; |
| InChIKey | IPSWDIQIVBHSQS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|