C19H24LiO4P — CID 173244504
lithium;(2,6-dimethoxyphenyl)-[4-(2-methylpropoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173244504) has the molecular formula C19H24LiO4P and a molecular weight of 354.31 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-[4-(2-methylpropoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-[4-(2-methylpropoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244504 |
| Molecular Formula | C19H24LiO4P |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-[4-(2-methylpropoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COc1cccc(OC)c1C(=O)Pc1ccc(OCC(C)C)cc1.[H-].[Li+] |
| InChI | InChI=1S/C19H23O4P.Li.H/c1-13(2)12-23-14-8-10-15(11-9-14)24-19(20)18-16(21-3)6-5-7-17(18)22-4;;/h5-11,13,24H,12H2,1-4H3;;/q;+1;-1 |
| InChIKey | XSWLGWCQGQOKNO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|