C33H21F6LiO4P+ — CID 18515297
lithium [2,6-bis(trifluoromethyl)phenyl]-(2,4,6-triphenoxyphenyl)phosphanylmethanone (PubChem CID 18515297) has the molecular formula C33H21F6LiO4P+ and a molecular weight of 633.43 g/mol. Its IUPAC name is lithium [2,6-bis(trifluoromethyl)phenyl]-(2,4,6-triphenoxyphenyl)phosphanylmethanone.
| Compound Name | lithium [2,6-bis(trifluoromethyl)phenyl]-(2,4,6-triphenoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18515297 |
| Molecular Formula | C33H21F6LiO4P+ |
| Molecular Weight | 633.43 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | lithium [2,6-bis(trifluoromethyl)phenyl]-(2,4,6-triphenoxyphenyl)phosphanylmethanone |
| SMILES | O=C(Pc1c(Oc2ccccc2)cc(Oc2ccccc2)cc1Oc1ccccc1)c1c(C(F)(F)F)cccc1C(F)(F)F.[Li+] |
| InChI | InChI=1S/C33H21F6O4P.Li/c34-32(35,36)25-17-10-18-26(33(37,38)39)29(25)31(40)44-30-27(42-22-13-6-2-7-14-22)19-24(41-21-11-4-1-5-12-21)20-28(30)43-23-15-8-3-9-16-23;/h1-20,44H;/q;+1 |
| InChIKey | FSVSNKHHBRBNBO-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.43 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|