C22H23F6O3P — CID 158856572
[2,6-bis(trifluoromethyl)phenyl]-phenylphosphanylmethanone;pentyl acetate (PubChem CID 158856572) has the molecular formula C22H23F6O3P and a molecular weight of 480.39 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-phenylphosphanylmethanone;pentyl acetate.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-phenylphosphanylmethanone;pentyl acetate |
|---|---|
| PubChem CID | 158856572 |
| Molecular Formula | C22H23F6O3P |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-phenylphosphanylmethanone;pentyl acetate |
| SMILES | CCCCCOC(C)=O.O=C(Pc1ccccc1)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C15H9F6OP.C7H14O2/c16-14(17,18)10-7-4-8-11(15(19,20)21)12(10)13(22)23-9-5-2-1-3-6-9;1-3-4-5-6-9-7(2)8/h1-8,23H;3-6H2,1-2H3 |
| InChIKey | JACZRUSNPQMVBG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|