About pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate
pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate (PubChem CID 18513815) has the molecular formula C22H20F6O3
and a molecular weight of 446.39 g/mol. Its IUPAC name is pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate.
Molecular Properties
| Compound Name | pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate |
| PubChem CID | 18513815 |
| Molecular Formula | C22H20F6O3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate |
| SMILES | CCCCCOC(=O)C(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H20F6O3/c1-2-3-7-13-31-20(30)17(14-9-5-4-6-10-14)19(29)18-15(21(23,24)25)11-8-12-16(18)22(26,27)28/h4-6,8-12,17H,2-3,7,13H2,1H3 |
| InChIKey | YNTZENBBOHODNM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate?
The IUPAC name of pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate (CID 18513815) is pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate.
What is the SMILES notation for pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate?
The canonical SMILES for pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate is CCCCCOC(=O)C(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1.
What is the InChIKey of pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate?
The InChIKey is YNTZENBBOHODNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F6O3/c1-2-3-7-13-31-20(30)17(14-9-5-4-6-10-14)19(29)18-15(21(23,24)25)11-8-12-16(18)22(26,27)28/h4-6,8-12,17H,2-3,7,13H2,1H3.
What are the key properties of pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate?
pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate has a molecular weight of 446.39 g/mol, XLogP of 6.42, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate is sourced from PubChem (CID 18513815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).