C22H20F6O3 — CID 18513815
pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate (PubChem CID 18513815) has the molecular formula C22H20F6O3 and a molecular weight of 446.39 g/mol. Its IUPAC name is pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate.
| Compound Name | pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 18513815 |
| Molecular Formula | C22H20F6O3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | pentyl 3-[2,6-bis(trifluoromethyl)phenyl]-3-oxo-2-phenylpropanoate |
| SMILES | CCCCCOC(=O)C(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H20F6O3/c1-2-3-7-13-31-20(30)17(14-9-5-4-6-10-14)19(29)18-15(21(23,24)25)11-8-12-16(18)22(26,27)28/h4-6,8-12,17H,2-3,7,13H2,1H3 |
| InChIKey | YNTZENBBOHODNM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|