C16H16ClOP — CID 18513613
(2-chloro-6-methylphenyl)-(2,5-dimethylphenyl)phosphanylmethanone (PubChem CID 18513613) has the molecular formula C16H16ClOP and a molecular weight of 290.73 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)-(2,5-dimethylphenyl)phosphanylmethanone.
| Compound Name | (2-chloro-6-methylphenyl)-(2,5-dimethylphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513613 |
| Molecular Formula | C16H16ClOP |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2-chloro-6-methylphenyl)-(2,5-dimethylphenyl)phosphanylmethanone |
| SMILES | Cc1ccc(C)c(PC(=O)c2c(C)cccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClOP/c1-10-7-8-11(2)14(9-10)19-16(18)15-12(3)5-4-6-13(15)17/h4-9,19H,1-3H3 |
| InChIKey | OTKJGJGLAFXVOU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|