C22H29ClLiO3P — CID 173244571
lithium;[2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methylphenyl)methanone;hydride (PubChem CID 173244571) has the molecular formula C22H29ClLiO3P and a molecular weight of 414.84 g/mol. Its IUPAC name is lithium;[2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methylphenyl)methanone;hydride.
| Compound Name | lithium;[2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244571 |
| Molecular Formula | C22H29ClLiO3P |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | lithium;[2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methylphenyl)methanone;hydride |
| SMILES | Cc1cccc(Cl)c1C(=O)Pc1ccc(OCC(C)C)cc1OCC(C)C.[H-].[Li+] |
| InChI | InChI=1S/C22H28ClO3P.Li.H/c1-14(2)12-25-17-9-10-20(19(11-17)26-13-15(3)4)27-22(24)21-16(5)7-6-8-18(21)23;;/h6-11,14-15,27H,12-13H2,1-5H3;;/q;+1;-1 |
| InChIKey | RSCBSMJICJEKAM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|