C30H28LiO3P — CID 141015872
lithium [2,4-bis(phenylmethoxy)phenyl]-(2,4,6-trimethylbenzoyl)phosphanide (PubChem CID 141015872) has the molecular formula C30H28LiO3P and a molecular weight of 474.47 g/mol. Its IUPAC name is lithium [2,4-bis(phenylmethoxy)phenyl]-(2,4,6-trimethylbenzoyl)phosphanide.
| Compound Name | lithium [2,4-bis(phenylmethoxy)phenyl]-(2,4,6-trimethylbenzoyl)phosphanide |
|---|---|
| PubChem CID | 141015872 |
| Molecular Formula | C30H28LiO3P |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | lithium [2,4-bis(phenylmethoxy)phenyl]-(2,4,6-trimethylbenzoyl)phosphanide |
| SMILES | Cc1cc(C)c(C(=O)[P-]c2ccc(OCc3ccccc3)cc2OCc2ccccc2)c(C)c1.[Li+] |
| InChI | InChI=1S/C30H28O3P.Li/c1-21-16-22(2)29(23(3)17-21)30(31)34-28-15-14-26(32-19-24-10-6-4-7-11-24)18-27(28)33-20-25-12-8-5-9-13-25;/h4-18H,19-20H2,1-3H3;/q-1;+1 |
| InChIKey | OUBHCHYLYCBFOO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|