C20H24LiO2P — CID 141016660
lithium (2,6-dimethylbenzoyl)-[2-methyl-4-(2-methylpropoxy)phenyl]phosphanide (PubChem CID 141016660) has the molecular formula C20H24LiO2P and a molecular weight of 334.32 g/mol. Its IUPAC name is lithium (2,6-dimethylbenzoyl)-[2-methyl-4-(2-methylpropoxy)phenyl]phosphanide.
| Compound Name | lithium (2,6-dimethylbenzoyl)-[2-methyl-4-(2-methylpropoxy)phenyl]phosphanide |
|---|---|
| PubChem CID | 141016660 |
| Molecular Formula | C20H24LiO2P |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | lithium (2,6-dimethylbenzoyl)-[2-methyl-4-(2-methylpropoxy)phenyl]phosphanide |
| SMILES | Cc1cc(OCC(C)C)ccc1[P-]C(=O)c1c(C)cccc1C.[Li+] |
| InChI | InChI=1S/C20H24O2P.Li/c1-13(2)12-22-17-9-10-18(16(5)11-17)23-20(21)19-14(3)7-6-8-15(19)4;/h6-11,13H,12H2,1-5H3;/q-1;+1 |
| InChIKey | LYPPFEAWHRPOBZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|