C17H16Cl2LiO2P — CID 141015990
lithium (2,6-dichlorobenzoyl)-[4-(2-methylpropoxy)phenyl]phosphanide (PubChem CID 141015990) has the molecular formula C17H16Cl2LiO2P and a molecular weight of 361.13 g/mol. Its IUPAC name is lithium (2,6-dichlorobenzoyl)-[4-(2-methylpropoxy)phenyl]phosphanide.
| Compound Name | lithium (2,6-dichlorobenzoyl)-[4-(2-methylpropoxy)phenyl]phosphanide |
|---|---|
| PubChem CID | 141015990 |
| Molecular Formula | C17H16Cl2LiO2P |
| Molecular Weight | 361.13 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | lithium (2,6-dichlorobenzoyl)-[4-(2-methylpropoxy)phenyl]phosphanide |
| SMILES | CC(C)COc1ccc([P-]C(=O)c2c(Cl)cccc2Cl)cc1.[Li+] |
| InChI | InChI=1S/C17H16Cl2O2P.Li/c1-11(2)10-21-12-6-8-13(9-7-12)22-17(20)16-14(18)4-3-5-15(16)19;/h3-9,11H,10H2,1-2H3;/q-1;+1 |
| InChIKey | FHJSKUZRGUBUDL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|