C18H19Cl2O2P — CID 18513729
(2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone (PubChem CID 18513729) has the molecular formula C18H19Cl2O2P and a molecular weight of 369.23 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone.
| Compound Name | (2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18513729 |
| Molecular Formula | C18H19Cl2O2P |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone |
| SMILES | CC(C)CCOc1ccc(PC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2O2P/c1-12(2)10-11-22-13-6-8-14(9-7-13)23-18(21)17-15(19)4-3-5-16(17)20/h3-9,12,23H,10-11H2,1-2H3 |
| InChIKey | UVKNECCNKZPNJW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|