C19H22ClLiO2P — CID 70014538
CID 70014538 (PubChem CID 70014538) has the molecular formula C19H22ClLiO2P and a molecular weight of 355.75 g/mol.
| Compound Name | CID 70014538 |
|---|---|
| PubChem CID | 70014538 |
| Molecular Formula | C19H22ClLiO2P |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc(Cl)c1C(=O)Pc1ccc(OCCC(C)C)cc1.[Li] |
| InChI | InChI=1S/C19H22ClO2P.Li/c1-13(2)11-12-22-15-7-9-16(10-8-15)23-19(21)18-14(3)5-4-6-17(18)20;/h4-10,13,23H,11-12H2,1-3H3; |
| InChIKey | CUEANPNZONMGHZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|