C18H21O2P — CID 18513885
(2,6-dimethylphenyl)-(4-propoxyphenyl)phosphanylmethanone (PubChem CID 18513885) has the molecular formula C18H21O2P and a molecular weight of 300.34 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(4-propoxyphenyl)phosphanylmethanone.
| Compound Name | (2,6-dimethylphenyl)-(4-propoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513885 |
| Molecular Formula | C18H21O2P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2,6-dimethylphenyl)-(4-propoxyphenyl)phosphanylmethanone |
| SMILES | CCCOc1ccc(PC(=O)c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C18H21O2P/c1-4-12-20-15-8-10-16(11-9-15)21-18(19)17-13(2)6-5-7-14(17)3/h5-11,21H,4,12H2,1-3H3 |
| InChIKey | APDGUAQAEPBGQJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|