C30H28O3P- — CID 141015873
[2,4-bis(phenylmethoxy)phenyl]phosphanylidene-(2,4,6-trimethylphenyl)methanolate (PubChem CID 141015873) has the molecular formula C30H28O3P- and a molecular weight of 467.53 g/mol. Its IUPAC name is [2,4-bis(phenylmethoxy)phenyl]phosphanylidene-(2,4,6-trimethylphenyl)methanolate.
| Compound Name | [2,4-bis(phenylmethoxy)phenyl]phosphanylidene-(2,4,6-trimethylphenyl)methanolate |
|---|---|
| PubChem CID | 141015873 |
| Molecular Formula | C30H28O3P- |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [2,4-bis(phenylmethoxy)phenyl]phosphanylidene-(2,4,6-trimethylphenyl)methanolate |
| SMILES | Cc1cc(C)c(/C([O-])=P/c2ccc(OCc3ccccc3)cc2OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H29O3P/c1-21-16-22(2)29(23(3)17-21)30(31)34-28-15-14-26(32-19-24-10-6-4-7-11-24)18-27(28)33-20-25-12-8-5-9-13-25/h4-18,31H,19-20H2,1-3H3/p-1 |
| InChIKey | DZAVFOGODATPJA-UHFFFAOYSA-M |
| XLogP | 5.88 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|