C18H20Br2O2Te — CID 177439881
2-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 177439881) has the molecular formula C18H20Br2O2Te and a molecular weight of 555.76 g/mol. Its IUPAC name is 2-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 177439881 |
| Molecular Formula | C18H20Br2O2Te |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.89 |
| IUPAC Name | 2-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | COc1ccc([Te](Br)(Br)CC(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H20Br2O2Te/c1-12-9-13(2)18(14(3)10-12)17(21)11-23(19,20)16-7-5-15(22-4)6-8-16/h5-10H,11H2,1-4H3 |
| InChIKey | ZIGARMIMKPFHPX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|