C25H29BiO — CID 166511638
(4-methoxyphenyl)-bis(2,4,6-trimethylphenyl)bismuthane (PubChem CID 166511638) has the molecular formula C25H29BiO and a molecular weight of 554.49 g/mol. Its IUPAC name is (4-methoxyphenyl)-bis(2,4,6-trimethylphenyl)bismuthane.
| Compound Name | (4-methoxyphenyl)-bis(2,4,6-trimethylphenyl)bismuthane |
|---|---|
| PubChem CID | 166511638 |
| Molecular Formula | C25H29BiO |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (4-methoxyphenyl)-bis(2,4,6-trimethylphenyl)bismuthane |
| SMILES | COc1ccc([Bi](c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/2C9H11.C7H7O.Bi/c2*1-7-4-8(2)6-9(3)5-7;1-8-7-5-3-2-4-6-7;/h2*4-5H,1-3H3;3-6H,1H3; |
| InChIKey | SCFUXPZHZCMXMR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |