C16H18OS — CID 13052775
2-(4-methoxyphenyl)sulfanyl-1,3,5-trimethylbenzene (PubChem CID 13052775) has the molecular formula C16H18OS and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfanyl-1,3,5-trimethylbenzene.
| Compound Name | 2-(4-methoxyphenyl)sulfanyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 13052775 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfanyl-1,3,5-trimethylbenzene |
| SMILES | COc1ccc(Sc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C16H18OS/c1-11-9-12(2)16(13(3)10-11)18-15-7-5-14(17-4)6-8-15/h5-10H,1-4H3 |
| InChIKey | JUCOTJKNSAGSJA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |