C15H16O3S — CID 176734451
1,3-dimethoxy-5-(4-methoxyphenyl)sulfanylbenzene (PubChem CID 176734451) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1,3-dimethoxy-5-(4-methoxyphenyl)sulfanylbenzene.
| Compound Name | 1,3-dimethoxy-5-(4-methoxyphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 176734451 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1,3-dimethoxy-5-(4-methoxyphenyl)sulfanylbenzene |
| SMILES | COc1ccc(Sc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C15H16O3S/c1-16-11-4-6-14(7-5-11)19-15-9-12(17-2)8-13(10-15)18-3/h4-10H,1-3H3 |
| InChIKey | XQYHRRHHISBJCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |