C16H15ClO4S — CID 15512442
2-[2-chloro-5-(3,5-dimethoxyphenyl)sulfanylphenyl]acetic acid (PubChem CID 15512442) has the molecular formula C16H15ClO4S and a molecular weight of 338.81 g/mol. Its IUPAC name is 2-[2-chloro-5-(3,5-dimethoxyphenyl)sulfanylphenyl]acetic acid.
| Compound Name | 2-[2-chloro-5-(3,5-dimethoxyphenyl)sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 15512442 |
| Molecular Formula | C16H15ClO4S |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[2-chloro-5-(3,5-dimethoxyphenyl)sulfanylphenyl]acetic acid |
| SMILES | COc1cc(OC)cc(Sc2ccc(Cl)c(CC(=O)O)c2)c1 |
| InChI | InChI=1S/C16H15ClO4S/c1-20-11-7-12(21-2)9-14(8-11)22-13-3-4-15(17)10(5-13)6-16(18)19/h3-5,7-9H,6H2,1-2H3,(H,18,19) |
| InChIKey | SQJCFOSTBYJWPF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |