C14H10Cl2O3S — CID 81308961
2-(3,4-dichlorophenyl)sulfanyl-4-methoxybenzoic acid (PubChem CID 81308961) has the molecular formula C14H10Cl2O3S and a molecular weight of 329.20 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfanyl-4-methoxybenzoic acid.
| Compound Name | 2-(3,4-dichlorophenyl)sulfanyl-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 81308961 |
| Molecular Formula | C14H10Cl2O3S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfanyl-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(Sc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H10Cl2O3S/c1-19-8-2-4-10(14(17)18)13(6-8)20-9-3-5-11(15)12(16)7-9/h2-7H,1H3,(H,17,18) |
| InChIKey | YAFGXXVMQVMUIN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |