C17H16O3S — CID 81301525
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-4-methoxybenzoic acid (PubChem CID 81301525) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-4-methoxybenzoic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 81301525 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(Sc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C17H16O3S/c1-20-13-6-8-15(17(18)19)16(10-13)21-14-7-5-11-3-2-4-12(11)9-14/h5-10H,2-4H2,1H3,(H,18,19) |
| InChIKey | ZMMBLTNPYQWWEP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |