C18H21N — CID 145272751
(Z)-1,4-diphenylbut-2-en-1-imine;ethane (PubChem CID 145272751) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (Z)-1,4-diphenylbut-2-en-1-imine;ethane.
| Compound Name | (Z)-1,4-diphenylbut-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 145272751 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (Z)-1,4-diphenylbut-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C(\C=C/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N.C2H6/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14;1-2/h1-9,11-13,17H,10H2;1-2H3/b13-7-,17-16+; |
| InChIKey | WLLWRGXIGOSVMW-MTLHKZOGSA-N |
| XLogP | 4.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|