C29H32N2 — CID 145387103
(Z)-1,4-diphenylbut-2-en-1-imine;ethane;1-methyl-2-phenylpyrrole (PubChem CID 145387103) has the molecular formula C29H32N2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (Z)-1,4-diphenylbut-2-en-1-imine;ethane;1-methyl-2-phenylpyrrole.
| Compound Name | (Z)-1,4-diphenylbut-2-en-1-imine;ethane;1-methyl-2-phenylpyrrole |
|---|---|
| PubChem CID | 145387103 |
| Molecular Formula | C29H32N2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (Z)-1,4-diphenylbut-2-en-1-imine;ethane;1-methyl-2-phenylpyrrole |
| SMILES | CC.Cn1cccc1-c1ccccc1.[H]/N=C(\C=C/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N.C11H11N.C2H6/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14;1-12-9-5-8-11(12)10-6-3-2-4-7-10;1-2/h1-9,11-13,17H,10H2;2-9H,1H3;1-2H3/b13-7-,17-16+;; |
| InChIKey | WPLCCQQPFUQATJ-YBFSCFFASA-N |
| XLogP | 7.57 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|