C35H35FN2 — CID 144876370
ethane;(Z)-4-(6-fluoro-1,4-dihydrocyclopenta[a]inden-5-yl)-2-phenylbut-2-en-1-imine;1-methyl-2-phenylpyrrole (PubChem CID 144876370) has the molecular formula C35H35FN2 and a molecular weight of 502.68 g/mol. Its IUPAC name is ethane;(Z)-4-(6-fluoro-1,4-dihydrocyclopenta[a]inden-5-yl)-2-phenylbut-2-en-1-imine;1-methyl-2-phenylpyrrole.
| Compound Name | ethane;(Z)-4-(6-fluoro-1,4-dihydrocyclopenta[a]inden-5-yl)-2-phenylbut-2-en-1-imine;1-methyl-2-phenylpyrrole |
|---|---|
| PubChem CID | 144876370 |
| Molecular Formula | C35H35FN2 |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | ethane;(Z)-4-(6-fluoro-1,4-dihydrocyclopenta[a]inden-5-yl)-2-phenylbut-2-en-1-imine;1-methyl-2-phenylpyrrole |
| SMILES | CC.Cn1cccc1-c1ccccc1.[H]/N=C/C(=C\Cc1c(F)ccc2c1CC1=C2CC=C1)c1ccccc1 |
| InChI | InChI=1S/C22H18FN.C11H11N.C2H6/c23-22-12-11-19-18-8-4-7-16(18)13-21(19)20(22)10-9-17(14-24)15-5-2-1-3-6-15;1-12-9-5-8-11(12)10-6-3-2-4-7-10;1-2/h1-7,9,11-12,14,24H,8,10,13H2;2-9H,1H3;1-2H3/b17-9+,24-14+;; |
| InChIKey | NRYBLZUBGBOVBB-VTYZLPEMSA-N |
| XLogP | 9.09 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|