C30H27N — CID 142425002
(Z)-2-[4-[4-[(E)-1-phenylbut-1-enyl]phenyl]naphthalen-1-yl]but-2-en-1-imine (PubChem CID 142425002) has the molecular formula C30H27N and a molecular weight of 401.55 g/mol. Its IUPAC name is (Z)-2-[4-[4-[(E)-1-phenylbut-1-enyl]phenyl]naphthalen-1-yl]but-2-en-1-imine.
| Compound Name | (Z)-2-[4-[4-[(E)-1-phenylbut-1-enyl]phenyl]naphthalen-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 142425002 |
| Molecular Formula | C30H27N |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (Z)-2-[4-[4-[(E)-1-phenylbut-1-enyl]phenyl]naphthalen-1-yl]but-2-en-1-imine |
| SMILES | [H]/N=C/C(=C\C)c1ccc(-c2ccc(/C(=C/CC)c3ccccc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C30H27N/c1-3-10-26(23-11-6-5-7-12-23)24-15-17-25(18-16-24)28-20-19-27(22(4-2)21-31)29-13-8-9-14-30(28)29/h4-21,31H,3H2,1-2H3/b22-4+,26-10+,31-21+ |
| InChIKey | FZACXAKOXCYJSF-QSXJSSPCSA-N |
| XLogP | 8.40 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|