C28H28N2+2 — CID 176918724
12-methyl-10-phenyl-6-[(Z)-1-phenylbut-1-enyl]-1,4-diazoniatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene (PubChem CID 176918724) has the molecular formula C28H28N2+2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 12-methyl-10-phenyl-6-[(Z)-1-phenylbut-1-enyl]-1,4-diazoniatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene.
| Compound Name | 12-methyl-10-phenyl-6-[(Z)-1-phenylbut-1-enyl]-1,4-diazoniatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 176918724 |
| Molecular Formula | C28H28N2+2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 12-methyl-10-phenyl-6-[(Z)-1-phenylbut-1-enyl]-1,4-diazoniatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene |
| SMILES | CC/C=C(/c1ccccc1)c1ccc2c(-c3ccccc3)cc(C)[n+]3c2c1[NH2+]CC3 |
| InChI | InChI=1S/C28H27N2/c1-3-10-23(21-11-6-4-7-12-21)24-15-16-25-26(22-13-8-5-9-14-22)19-20(2)30-18-17-29-27(24)28(25)30/h4-16,19,29H,3,17-18H2,1-2H3/q+1/p+1/b23-10- |
| InChIKey | XNEJTQYXUIJTJS-RMORIDSASA-O |
| XLogP | 5.15 |
| TPSA | 20.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|