About 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole
6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole (PubChem CID 123746411) has the molecular formula C32H32N4
and a molecular weight of 472.64 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole |
| PubChem CID | 123746411 |
| Molecular Formula | C32H32N4 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole |
| SMILES | CCC=C(c1ccccc1)c1ccnc2[nH]c3ccc(-c4ccc(N5CCN(C)CC5)cc4)cc3c12 |
| InChI | InChI=1S/C32H32N4/c1-3-7-27(24-8-5-4-6-9-24)28-16-17-33-32-31(28)29-22-25(12-15-30(29)34-32)23-10-13-26(14-11-23)36-20-18-35(2)19-21-36/h4-17,22H,3,18-21H2,1-2H3,(H,33,34) |
| InChIKey | JVLJDNLPCBISRM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole?
The IUPAC name of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole (CID 123746411) is 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole?
The canonical SMILES for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole is CCC=C(c1ccccc1)c1ccnc2[nH]c3ccc(-c4ccc(N5CCN(C)CC5)cc4)cc3c12.
What is the InChIKey of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole?
The InChIKey is JVLJDNLPCBISRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32N4/c1-3-7-27(24-8-5-4-6-9-24)28-16-17-33-32-31(28)29-22-25(12-15-30(29)34-32)23-10-13-26(14-11-23)36-20-18-35(2)19-21-36/h4-17,22H,3,18-21H2,1-2H3,(H,33,34).
What are the key properties of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole?
6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole has a molecular weight of 472.64 g/mol, XLogP of 6.98, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-phenylbut-1-enyl)-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 123746411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).