C23H23N5O — CID 172718111
N-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 172718111) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 172718111 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3nccc4c3[nH]c3ccccc34)cc2)CC1 |
| InChI | InChI=1S/C23H23N5O/c1-27-12-14-28(15-13-27)17-8-6-16(7-9-17)25-23(29)22-21-19(10-11-24-22)18-4-2-3-5-20(18)26-21/h2-11,26H,12-15H2,1H3,(H,25,29) |
| InChIKey | GDFMIABKMUGQDA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|