C30H27N5O — CID 44515355
N-[4-(4-methylpiperazin-1-yl)phenyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide (PubChem CID 44515355) has the molecular formula C30H27N5O and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 44515355 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(-c4cccc5ccccc45)c4nccnc34)cc2)CC1 |
| InChI | InChI=1S/C30H27N5O/c1-34-17-19-35(20-18-34)23-11-9-22(10-12-23)33-30(36)27-14-13-26(28-29(27)32-16-15-31-28)25-8-4-6-21-5-2-3-7-24(21)25/h2-16H,17-20H2,1H3,(H,33,36) |
| InChIKey | JAFYTYXWBXZWTP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|