C29H27N5O — CID 44515356
N-[5-(diethylaminomethyl)-2-pyridinyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide (PubChem CID 44515356) has the molecular formula C29H27N5O and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[5-(diethylaminomethyl)-2-pyridinyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide.
| Compound Name | N-[5-(diethylaminomethyl)-2-pyridinyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 44515356 |
| Molecular Formula | C29H27N5O |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N-[5-(diethylaminomethyl)-2-pyridinyl]-8-naphthalen-1-ylquinoxaline-5-carboxamide |
| SMILES | CCN(CC)Cc1ccc(NC(=O)c2ccc(-c3cccc4ccccc34)c3nccnc23)nc1 |
| InChI | InChI=1S/C29H27N5O/c1-3-34(4-2)19-20-12-15-26(32-18-20)33-29(35)25-14-13-24(27-28(25)31-17-16-30-27)23-11-7-9-21-8-5-6-10-22(21)23/h5-18H,3-4,19H2,1-2H3,(H,32,33,35) |
| InChIKey | IQBALXPGNZKGRX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |