C24H24N8 — CID 44594539
12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 44594539) has the molecular formula C24H24N8 and a molecular weight of 424.51 g/mol. Its IUPAC name is 12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 44594539 |
| Molecular Formula | C24H24N8 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]c5cnc(-c6cnn(C)c6)nc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C24H24N8/c1-30-7-9-32(10-8-30)19-5-3-16(4-6-19)17-11-20-22-21(28-24(20)25-12-17)14-26-23(29-22)18-13-27-31(2)15-18/h3-6,11-15H,7-10H2,1-2H3,(H,25,28) |
| InChIKey | DZKZWMOBMZIDES-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |