C18H19IN4 — CID 138754280
3-iodo-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 138754280) has the molecular formula C18H19IN4 and a molecular weight of 418.28 g/mol. Its IUPAC name is 3-iodo-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-iodo-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 138754280 |
| Molecular Formula | C18H19IN4 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 3-iodo-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]cc(I)c4c3)cc2)CC1 |
| InChI | InChI=1S/C18H19IN4/c1-22-6-8-23(9-7-22)15-4-2-13(3-5-15)14-10-16-17(19)12-21-18(16)20-11-14/h2-5,10-12H,6-9H2,1H3,(H,20,21) |
| InChIKey | WTIHGSOBJGNILW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|