C29H29N5O — CID 155777489
N,N-dimethyl-4-[2-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzamide (PubChem CID 155777489) has the molecular formula C29H29N5O and a molecular weight of 463.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzamide.
| Compound Name | N,N-dimethyl-4-[2-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 155777489 |
| Molecular Formula | C29H29N5O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N,N-dimethyl-4-[2-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzamide |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]cc(C#Cc5ccc(C(=O)N(C)C)cc5)c4c3)cc2)CC1 |
| InChI | InChI=1S/C29H29N5O/c1-32(2)29(35)23-7-4-21(5-8-23)6-9-24-19-30-28-27(24)18-25(20-31-28)22-10-12-26(13-11-22)34-16-14-33(3)15-17-34/h4-5,7-8,10-13,18-20H,14-17H2,1-3H3,(H,30,31) |
| InChIKey | HNBFIXDLZJMYOP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|