C24H23ClN8 — CID 44594394
6-chloro-12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 44594394) has the molecular formula C24H23ClN8 and a molecular weight of 458.96 g/mol. Its IUPAC name is 6-chloro-12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-chloro-12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 44594394 |
| Molecular Formula | C24H23ClN8 |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 6-chloro-12-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1-methylpyrazol-4-yl)-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]c5c(Cl)nc(-c6cnn(C)c6)nc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C24H23ClN8/c1-31-7-9-33(10-8-31)18-5-3-15(4-6-18)16-11-19-20-21(29-24(19)26-12-16)22(25)30-23(28-20)17-13-27-32(2)14-17/h3-6,11-14H,7-10H2,1-2H3,(H,26,29) |
| InChIKey | JZXCUAXRQTZRMK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |