C29H30N4O2 — CID 11525592
3-[4-[4-[4-(4-methylpiperazin-1-yl)anilino]quinolin-6-yl]phenyl]propanoic acid (PubChem CID 11525592) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 3-[4-[4-[4-(4-methylpiperazin-1-yl)anilino]quinolin-6-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-[4-(4-methylpiperazin-1-yl)anilino]quinolin-6-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11525592 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 3-[4-[4-[4-(4-methylpiperazin-1-yl)anilino]quinolin-6-yl]phenyl]propanoic acid |
| SMILES | CN1CCN(c2ccc(Nc3ccnc4ccc(-c5ccc(CCC(=O)O)cc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C29H30N4O2/c1-32-16-18-33(19-17-32)25-10-8-24(9-11-25)31-28-14-15-30-27-12-7-23(20-26(27)28)22-5-2-21(3-6-22)4-13-29(34)35/h2-3,5-12,14-15,20H,4,13,16-19H2,1H3,(H,30,31)(H,34,35) |
| InChIKey | JHPQIINFTGWYMR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|