C19H18N4O2 — CID 157044241
methyl 5-[[6-(azetidin-1-yl)quinolin-4-yl]amino]pyridine-2-carboxylate (PubChem CID 157044241) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 5-[[6-(azetidin-1-yl)quinolin-4-yl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[6-(azetidin-1-yl)quinolin-4-yl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 157044241 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl 5-[[6-(azetidin-1-yl)quinolin-4-yl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2ccnc3ccc(N4CCC4)cc23)cn1 |
| InChI | InChI=1S/C19H18N4O2/c1-25-19(24)18-5-3-13(12-21-18)22-17-7-8-20-16-6-4-14(11-15(16)17)23-9-2-10-23/h3-8,11-12H,2,9-10H2,1H3,(H,20,22) |
| InChIKey | PFWSTNKVVZFAOI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |