C23H25N3O2 — CID 23854503
methyl 2-methyl-4-(4-piperidin-1-ylanilino)quinoline-6-carboxylate (PubChem CID 23854503) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 2-methyl-4-(4-piperidin-1-ylanilino)quinoline-6-carboxylate.
| Compound Name | methyl 2-methyl-4-(4-piperidin-1-ylanilino)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 23854503 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | methyl 2-methyl-4-(4-piperidin-1-ylanilino)quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(C)cc(Nc3ccc(N4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C23H25N3O2/c1-16-14-22(20-15-17(23(27)28-2)6-11-21(20)24-16)25-18-7-9-19(10-8-18)26-12-4-3-5-13-26/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,25) |
| InChIKey | BRRUDBNVEKELRA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|