C26H26N4 — CID 91408715
2-[4-(4-methylpiperazin-1-yl)phenyl]-6-phenylquinolin-4-amine (PubChem CID 91408715) has the molecular formula C26H26N4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)phenyl]-6-phenylquinolin-4-amine.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-6-phenylquinolin-4-amine |
|---|---|
| PubChem CID | 91408715 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-6-phenylquinolin-4-amine |
| SMILES | CN1CCN(c2ccc(-c3cc(N)c4cc(-c5ccccc5)ccc4n3)cc2)CC1 |
| InChI | InChI=1S/C26H26N4/c1-29-13-15-30(16-14-29)22-10-7-20(8-11-22)26-18-24(27)23-17-21(9-12-25(23)28-26)19-5-3-2-4-6-19/h2-12,17-18H,13-16H2,1H3,(H2,27,28) |
| InChIKey | DGVQYZCSZMHBPW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |