C18H24N4 — CID 167284954
2-N-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]benzene-1,2-diamine (PubChem CID 167284954) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-N-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 167284954 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-N-methyl-4-[4-(4-methylpiperazin-1-yl)phenyl]benzene-1,2-diamine |
| SMILES | CNc1cc(-c2ccc(N3CCN(C)CC3)cc2)ccc1N |
| InChI | InChI=1S/C18H24N4/c1-20-18-13-15(5-8-17(18)19)14-3-6-16(7-4-14)22-11-9-21(2)10-12-22/h3-8,13,20H,9-12,19H2,1-2H3 |
| InChIKey | HNPLIHSNLHYEFX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|