C17H19N5 — CID 150957046
6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 150957046) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 150957046 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CN1CCN(c2ccc(-c3cc4cncnc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C17H19N5/c1-21-6-8-22(9-7-21)15-4-2-13(3-5-15)16-10-14-11-18-12-19-17(14)20-16/h2-5,10-12H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | LLHKYLDLNUWIGX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|