C33H42N4S — CID 129303922
2-[6-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[2,3-b]indol-4-yl]ethynyl-tri(propan-2-yl)-λ4-sulfane (PubChem CID 129303922) has the molecular formula C33H42N4S and a molecular weight of 526.79 g/mol. Its IUPAC name is 2-[6-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[2,3-b]indol-4-yl]ethynyl-tri(propan-2-yl)-λ4-sulfane.
| Compound Name | 2-[6-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[2,3-b]indol-4-yl]ethynyl-tri(propan-2-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 129303922 |
| Molecular Formula | C33H42N4S |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 2-[6-[4-(4-methylpiperazin-1-yl)phenyl]-9H-pyrido[2,3-b]indol-4-yl]ethynyl-tri(propan-2-yl)-λ4-sulfane |
| SMILES | CC(C)S(C#Cc1ccnc2[nH]c3ccc(-c4ccc(N5CCN(C)CC5)cc4)cc3c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H42N4S/c1-23(2)38(24(3)4,25(5)6)21-15-27-14-16-34-33-32(27)30-22-28(10-13-31(30)35-33)26-8-11-29(12-9-26)37-19-17-36(7)18-20-37/h8-14,16,22-25H,17-20H2,1-7H3,(H,34,35) |
| InChIKey | SBIYVJKTMGOZOS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|